C24H21ClFN3O — CID 143664531
(3S,3aS)-2-[3-chloro-4-(methylamino)phenyl]-3-(4-fluorophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-7-ol (PubChem CID 143664531) has the molecular formula C24H21ClFN3O and a molecular weight of 421.90 g/mol. Its IUPAC name is (3S,3aS)-2-[3-chloro-4-(methylamino)phenyl]-3-(4-fluorophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-7-ol.
| Compound Name | (3S,3aS)-2-[3-chloro-4-(methylamino)phenyl]-3-(4-fluorophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-7-ol |
|---|---|
| PubChem CID | 143664531 |
| Molecular Formula | C24H21ClFN3O |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | (3S,3aS)-2-[3-chloro-4-(methylamino)phenyl]-3-(4-fluorophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-7-ol |
| SMILES | CNc1ccc(N2N=C3c4ccc(O)cc4CC[C@H]3[C@H]2c2ccc(F)cc2)cc1Cl |
| InChI | InChI=1S/C24H21ClFN3O/c1-27-22-11-7-17(13-21(22)25)29-24(14-2-5-16(26)6-3-14)20-9-4-15-12-18(30)8-10-19(15)23(20)28-29/h2-3,5-8,10-13,20,24,27,30H,4,9H2,1H3/t20-,24-/m1/s1 |
| InChIKey | XXVQJCDVMBQCMS-HYBUGGRVSA-N |
| XLogP | 5.75 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'} |
|---|