C25H25F3N4O2 — CID 162585263
2-amino-3-benzhydryl-7-[1-(1,1,1-trifluoropropan-2-yloxy)ethenyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 162585263) has the molecular formula C25H25F3N4O2 and a molecular weight of 470.50 g/mol. Its IUPAC name is 2-amino-3-benzhydryl-7-[1-(1,1,1-trifluoropropan-2-yloxy)ethenyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-amino-3-benzhydryl-7-[1-(1,1,1-trifluoropropan-2-yloxy)ethenyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 162585263 |
| Molecular Formula | C25H25F3N4O2 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 2-amino-3-benzhydryl-7-[1-(1,1,1-trifluoropropan-2-yloxy)ethenyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | C=C(OC(C)C(F)(F)F)N1CCc2c(nc(N)n(C(c3ccccc3)c3ccccc3)c2=O)C1 |
| InChI | InChI=1S/C25H25F3N4O2/c1-16(25(26,27)28)34-17(2)31-14-13-20-21(15-31)30-24(29)32(23(20)33)22(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,16,22H,2,13-15H2,1H3,(H2,29,30) |
| InChIKey | IDAXGZZMAMNMOJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|