C22H22F6N4O3 — CID 59415226
1,1,1,3,3,3-hexafluoropropan-2-yl 2-amino-3-(2-cyclopropyl-1-phenylethyl)-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate (PubChem CID 59415226) has the molecular formula C22H22F6N4O3 and a molecular weight of 504.43 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-amino-3-(2-cyclopropyl-1-phenylethyl)-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-amino-3-(2-cyclopropyl-1-phenylethyl)-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 59415226 |
| Molecular Formula | C22H22F6N4O3 |
| Molecular Weight | 504.43 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-amino-3-(2-cyclopropyl-1-phenylethyl)-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
| SMILES | Nc1nc2c(c(=O)n1C(CC1CC1)c1ccccc1)CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)C2 |
| InChI | InChI=1S/C22H22F6N4O3/c23-21(24,25)18(22(26,27)28)35-20(34)31-9-8-14-15(11-31)30-19(29)32(17(14)33)16(10-12-6-7-12)13-4-2-1-3-5-13/h1-5,12,16,18H,6-11H2,(H2,29,30) |
| InChIKey | VZXBPISRFZJXSV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |