C30H32F6IN3O3 — CID 162585482
4-(5-cyano-7-propan-2-yl-1,3-benzoxazol-2-yl)-N-[[4-[2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxyethyl]-1λ3-iodinan-1-yl]methyl]benzamide (PubChem CID 162585482) has the molecular formula C30H32F6IN3O3 and a molecular weight of 723.50 g/mol. Its IUPAC name is 4-(5-cyano-7-propan-2-yl-1,3-benzoxazol-2-yl)-N-[[4-[2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxyethyl]-1λ3-iodinan-1-yl]methyl]benzamide.
| Compound Name | 4-(5-cyano-7-propan-2-yl-1,3-benzoxazol-2-yl)-N-[[4-[2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxyethyl]-1λ3-iodinan-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 162585482 |
| Molecular Formula | C30H32F6IN3O3 |
| Molecular Weight | 723.50 g/mol |
| Exact Mass | 723.14 |
| IUPAC Name | 4-(5-cyano-7-propan-2-yl-1,3-benzoxazol-2-yl)-N-[[4-[2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxyethyl]-1λ3-iodinan-1-yl]methyl]benzamide |
| SMILES | CC(C)c1cc(C#N)cc2nc(-c3ccc(C(=O)NCI4CCC(CCOC(C)(C(F)(F)F)C(F)(F)F)CC4)cc3)oc12 |
| InChI | InChI=1S/C30H32F6IN3O3/c1-18(2)23-14-20(16-38)15-24-25(23)43-27(40-24)22-6-4-21(5-7-22)26(41)39-17-37-11-8-19(9-12-37)10-13-42-28(3,29(31,32)33)30(34,35)36/h4-7,14-15,18-19H,8-13,17H2,1-3H3,(H,39,41) |
| InChIKey | QWFOVBDPWXPPPJ-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.50 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|