C32H31F3N4O2 — CID 59585997
4-(5-isocyano-7-propan-2-yl-1,3-benzoxazol-2-yl)-N-[[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]methyl]benzamide (PubChem CID 59585997) has the molecular formula C32H31F3N4O2 and a molecular weight of 560.62 g/mol. Its IUPAC name is 4-(5-isocyano-7-propan-2-yl-1,3-benzoxazol-2-yl)-N-[[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]methyl]benzamide.
| Compound Name | 4-(5-isocyano-7-propan-2-yl-1,3-benzoxazol-2-yl)-N-[[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 59585997 |
| Molecular Formula | C32H31F3N4O2 |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | 4-(5-isocyano-7-propan-2-yl-1,3-benzoxazol-2-yl)-N-[[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]methyl]benzamide |
| SMILES | [C-]#[N+]c1cc(C(C)C)c2oc(-c3ccc(C(=O)NCC4CCN(Cc5ccc(C(F)(F)F)cc5)CC4)cc3)nc2c1 |
| InChI | InChI=1S/C32H31F3N4O2/c1-20(2)27-16-26(36-3)17-28-29(27)41-31(38-28)24-8-6-23(7-9-24)30(40)37-18-21-12-14-39(15-13-21)19-22-4-10-25(11-5-22)32(33,34)35/h4-11,16-17,20-21H,12-15,18-19H2,1-2H3,(H,37,40) |
| InChIKey | YUUNPHPKAZXLJY-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|