C33H37N7O2 — CID 59586087
4-(5-isocyano-7-propan-2-yl-1,3-benzoxazol-2-yl)-N-[[1-(2-piperidin-1-ylpyrimidin-4-yl)piperidin-4-yl]methyl]benzamide (PubChem CID 59586087) has the molecular formula C33H37N7O2 and a molecular weight of 563.71 g/mol. Its IUPAC name is 4-(5-isocyano-7-propan-2-yl-1,3-benzoxazol-2-yl)-N-[[1-(2-piperidin-1-ylpyrimidin-4-yl)piperidin-4-yl]methyl]benzamide.
| Compound Name | 4-(5-isocyano-7-propan-2-yl-1,3-benzoxazol-2-yl)-N-[[1-(2-piperidin-1-ylpyrimidin-4-yl)piperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 59586087 |
| Molecular Formula | C33H37N7O2 |
| Molecular Weight | 563.71 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | 4-(5-isocyano-7-propan-2-yl-1,3-benzoxazol-2-yl)-N-[[1-(2-piperidin-1-ylpyrimidin-4-yl)piperidin-4-yl]methyl]benzamide |
| SMILES | [C-]#[N+]c1cc(C(C)C)c2oc(-c3ccc(C(=O)NCC4CCN(c5ccnc(N6CCCCC6)n5)CC4)cc3)nc2c1 |
| InChI | InChI=1S/C33H37N7O2/c1-22(2)27-19-26(34-3)20-28-30(27)42-32(37-28)25-9-7-24(8-10-25)31(41)36-21-23-12-17-39(18-13-23)29-11-14-35-33(38-29)40-15-5-4-6-16-40/h7-11,14,19-20,22-23H,4-6,12-13,15-18,21H2,1-2H3,(H,36,41) |
| InChIKey | ODWDLQCDZAFWRG-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.71 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|