C28H24ClN3O4 — CID 59435915
methyl 3-(4-chlorophenyl)-2-[[4-(5-isocyano-7-propan-2-yl-1,3-benzoxazol-2-yl)benzoyl]amino]propanoate (PubChem CID 59435915) has the molecular formula C28H24ClN3O4 and a molecular weight of 501.97 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-2-[[4-(5-isocyano-7-propan-2-yl-1,3-benzoxazol-2-yl)benzoyl]amino]propanoate.
| Compound Name | methyl 3-(4-chlorophenyl)-2-[[4-(5-isocyano-7-propan-2-yl-1,3-benzoxazol-2-yl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 59435915 |
| Molecular Formula | C28H24ClN3O4 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-2-[[4-(5-isocyano-7-propan-2-yl-1,3-benzoxazol-2-yl)benzoyl]amino]propanoate |
| SMILES | [C-]#[N+]c1cc(C(C)C)c2oc(-c3ccc(C(=O)NC(Cc4ccc(Cl)cc4)C(=O)OC)cc3)nc2c1 |
| InChI | InChI=1S/C28H24ClN3O4/c1-16(2)22-14-21(30-3)15-23-25(22)36-27(32-23)19-9-7-18(8-10-19)26(33)31-24(28(34)35-4)13-17-5-11-20(29)12-6-17/h5-12,14-16,24H,13H2,1-2,4H3,(H,31,33) |
| InChIKey | DROWJODPSPFRAG-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|