C42H42F9N3O6 — CID 162586041
4-[3-[[5,9-bis[[3-(4,4,4-trifluoro-1-hydroxy-3-oxobut-1-enyl)phenyl]methyl]-1,5,9-triazacyclododec-1-yl]methyl]phenyl]-1,1,1-trifluoro-4-hydroxybut-3-en-2-one (PubChem CID 162586041) has the molecular formula C42H42F9N3O6 and a molecular weight of 855.80 g/mol. Its IUPAC name is 4-[3-[[5,9-bis[[3-(4,4,4-trifluoro-1-hydroxy-3-oxobut-1-enyl)phenyl]methyl]-1,5,9-triazacyclododec-1-yl]methyl]phenyl]-1,1,1-trifluoro-4-hydroxybut-3-en-2-one.
| Compound Name | 4-[3-[[5,9-bis[[3-(4,4,4-trifluoro-1-hydroxy-3-oxobut-1-enyl)phenyl]methyl]-1,5,9-triazacyclododec-1-yl]methyl]phenyl]-1,1,1-trifluoro-4-hydroxybut-3-en-2-one |
|---|---|
| PubChem CID | 162586041 |
| Molecular Formula | C42H42F9N3O6 |
| Molecular Weight | 855.80 g/mol |
| Exact Mass | 855.29 |
| IUPAC Name | 4-[3-[[5,9-bis[[3-(4,4,4-trifluoro-1-hydroxy-3-oxobut-1-enyl)phenyl]methyl]-1,5,9-triazacyclododec-1-yl]methyl]phenyl]-1,1,1-trifluoro-4-hydroxybut-3-en-2-one |
| SMILES | O=C(C=C(O)c1cccc(CN2CCCN(Cc3cccc(C(O)=CC(=O)C(F)(F)F)c3)CCCN(Cc3cccc(C(O)=CC(=O)C(F)(F)F)c3)CCC2)c1)C(F)(F)F |
| InChI | InChI=1S/C42H42F9N3O6/c43-40(44,45)37(58)22-34(55)31-10-1-7-28(19-31)25-52-13-4-15-53(26-29-8-2-11-32(20-29)35(56)23-38(59)41(46,47)48)17-6-18-54(16-5-14-52)27-30-9-3-12-33(21-30)36(57)24-39(60)42(49,50)51/h1-3,7-12,19-24,55-57H,4-6,13-18,25-27H2 |
| InChIKey | REWIXUWONMVCTM-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.80 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|