C10H12F3NO3 — CID 162586754
(3Z)-1,1,1-trifluoro-5-[[(Z)-prop-1-enyl]iminomethyl]hexa-3,5-diene-2,2,4-triol (PubChem CID 162586754) has the molecular formula C10H12F3NO3 and a molecular weight of 251.20 g/mol. Its IUPAC name is (3Z)-1,1,1-trifluoro-5-[[(Z)-prop-1-enyl]iminomethyl]hexa-3,5-diene-2,2,4-triol.
| Compound Name | (3Z)-1,1,1-trifluoro-5-[[(Z)-prop-1-enyl]iminomethyl]hexa-3,5-diene-2,2,4-triol |
|---|---|
| PubChem CID | 162586754 |
| Molecular Formula | C10H12F3NO3 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | (3Z)-1,1,1-trifluoro-5-[[(Z)-prop-1-enyl]iminomethyl]hexa-3,5-diene-2,2,4-triol |
| SMILES | C=C(/C=N/C=C\C)/C(O)=C/C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO3/c1-3-4-14-6-7(2)8(15)5-9(16,17)10(11,12)13/h3-6,15-17H,2H2,1H3/b4-3-,8-5-,14-6+ |
| InChIKey | QUFSRSUKUBTUCB-OAIOIAAUSA-N |
| XLogP | 1.83 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|