C12H15F6NO — CID 142157346
ethane;(3E)-3-(ethenyliminomethyl)-1,1,1-trifluoro-2-(trifluoromethyl)hexa-3,5-dien-2-ol (PubChem CID 142157346) has the molecular formula C12H15F6NO and a molecular weight of 303.25 g/mol. Its IUPAC name is ethane;(3E)-3-(ethenyliminomethyl)-1,1,1-trifluoro-2-(trifluoromethyl)hexa-3,5-dien-2-ol.
| Compound Name | ethane;(3E)-3-(ethenyliminomethyl)-1,1,1-trifluoro-2-(trifluoromethyl)hexa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 142157346 |
| Molecular Formula | C12H15F6NO |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | ethane;(3E)-3-(ethenyliminomethyl)-1,1,1-trifluoro-2-(trifluoromethyl)hexa-3,5-dien-2-ol |
| SMILES | C=C/C=C(\C=N\C=C)C(O)(C(F)(F)F)C(F)(F)F.CC |
| InChI | InChI=1S/C10H9F6NO.C2H6/c1-3-5-7(6-17-4-2)8(18,9(11,12)13)10(14,15)16;1-2/h3-6,18H,1-2H2;1-2H3/b7-5+,17-6+; |
| InChIKey | KXANQQCIICQHBD-ISMCJLHXSA-N |
| XLogP | 4.20 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|