C9H5BrClF3N2O2 — CID 162587588
[6-bromo-3-chloro-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]methanediol (PubChem CID 162587588) has the molecular formula C9H5BrClF3N2O2 and a molecular weight of 345.50 g/mol. Its IUPAC name is [6-bromo-3-chloro-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]methanediol.
| Compound Name | [6-bromo-3-chloro-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]methanediol |
|---|---|
| PubChem CID | 162587588 |
| Molecular Formula | C9H5BrClF3N2O2 |
| Molecular Weight | 345.50 g/mol |
| Exact Mass | 343.92 |
| IUPAC Name | [6-bromo-3-chloro-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]methanediol |
| SMILES | OC(O)c1nc2c(C(F)(F)F)cc(Br)cn2c1Cl |
| InChI | InChI=1S/C9H5BrClF3N2O2/c10-3-1-4(9(12,13)14)7-15-5(8(17)18)6(11)16(7)2-3/h1-2,8,17-18H |
| InChIKey | BWAUXZSHBADCKE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|