C29H31ClF3N5O2 — CID 162588808
1-[4-chloro-5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-3-[4-[1-(3-piperidin-1-ylpropoxy)pyrrolo[3,2-c]pyridin-3-yl]phenyl]urea (PubChem CID 162588808) has the molecular formula C29H31ClF3N5O2 and a molecular weight of 574.05 g/mol. Its IUPAC name is 1-[4-chloro-5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-3-[4-[1-(3-piperidin-1-ylpropoxy)pyrrolo[3,2-c]pyridin-3-yl]phenyl]urea.
| Compound Name | 1-[4-chloro-5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-3-[4-[1-(3-piperidin-1-ylpropoxy)pyrrolo[3,2-c]pyridin-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 162588808 |
| Molecular Formula | C29H31ClF3N5O2 |
| Molecular Weight | 574.05 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | 1-[4-chloro-5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-3-[4-[1-(3-piperidin-1-ylpropoxy)pyrrolo[3,2-c]pyridin-3-yl]phenyl]urea |
| SMILES | O=C(NC1=CCC(Cl)C(C(F)(F)F)=C1)Nc1ccc(-c2cn(OCCCN3CCCCC3)c3ccncc23)cc1 |
| InChI | InChI=1S/C29H31ClF3N5O2/c30-26-10-9-22(17-25(26)29(31,32)33)36-28(39)35-21-7-5-20(6-8-21)24-19-38(27-11-12-34-18-23(24)27)40-16-4-15-37-13-2-1-3-14-37/h5-9,11-12,17-19,26H,1-4,10,13-16H2,(H2,35,36,39) |
| InChIKey | PPXUFALAGCMBPF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.05 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|