C19H20ClF3N2O2 — CID 162589205
N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-(dimethylamino)ethoxy]-N-methylbenzamide (PubChem CID 162589205) has the molecular formula C19H20ClF3N2O2 and a molecular weight of 400.83 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-(dimethylamino)ethoxy]-N-methylbenzamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-(dimethylamino)ethoxy]-N-methylbenzamide |
|---|---|
| PubChem CID | 162589205 |
| Molecular Formula | C19H20ClF3N2O2 |
| Molecular Weight | 400.83 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-(dimethylamino)ethoxy]-N-methylbenzamide |
| SMILES | CN(C)CCOc1cccc(C(=O)N(C)c2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H20ClF3N2O2/c1-24(2)9-10-27-15-6-4-5-13(11-15)18(26)25(3)14-7-8-17(20)16(12-14)19(21,22)23/h4-8,11-12H,9-10H2,1-3H3 |
| InChIKey | IRSPIFVJKUEKTG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.83 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |