C10H11F3N6O — CID 162589917
[[1,3-dimethyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-6-yl]amino]urea (PubChem CID 162589917) has the molecular formula C10H11F3N6O and a molecular weight of 288.23 g/mol. Its IUPAC name is [[1,3-dimethyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-6-yl]amino]urea.
| Compound Name | [[1,3-dimethyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-6-yl]amino]urea |
|---|---|
| PubChem CID | 162589917 |
| Molecular Formula | C10H11F3N6O |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | [[1,3-dimethyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridin-6-yl]amino]urea |
| SMILES | Cc1nn(C)c2nc(NNC(N)=O)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C10H11F3N6O/c1-4-7-5(10(11,12)13)3-6(16-17-9(14)20)15-8(7)19(2)18-4/h3H,1-2H3,(H,15,16)(H3,14,17,20) |
| InChIKey | VVYIYQUSNJJXTH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|