C12H14BrF3N2 — CID 176566976
6-bromo-1,3-dimethyl-4-(trifluoromethyl)indazole;ethane (PubChem CID 176566976) has the molecular formula C12H14BrF3N2 and a molecular weight of 323.16 g/mol. Its IUPAC name is 6-bromo-1,3-dimethyl-4-(trifluoromethyl)indazole;ethane.
| Compound Name | 6-bromo-1,3-dimethyl-4-(trifluoromethyl)indazole;ethane |
|---|---|
| PubChem CID | 176566976 |
| Molecular Formula | C12H14BrF3N2 |
| Molecular Weight | 323.16 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 6-bromo-1,3-dimethyl-4-(trifluoromethyl)indazole;ethane |
| SMILES | CC.Cc1nn(C)c2cc(Br)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C10H8BrF3N2.C2H6/c1-5-9-7(10(12,13)14)3-6(11)4-8(9)16(2)15-5;1-2/h3-4H,1-2H3;1-2H3 |
| InChIKey | VVGGVXDZEZNBLW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.16 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |