C12H15BrF2N2 — CID 176566236
6-bromo-4-(difluoromethyl)-1,3-dimethylindazole;ethane (PubChem CID 176566236) has the molecular formula C12H15BrF2N2 and a molecular weight of 305.17 g/mol. Its IUPAC name is 6-bromo-4-(difluoromethyl)-1,3-dimethylindazole;ethane.
| Compound Name | 6-bromo-4-(difluoromethyl)-1,3-dimethylindazole;ethane |
|---|---|
| PubChem CID | 176566236 |
| Molecular Formula | C12H15BrF2N2 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 6-bromo-4-(difluoromethyl)-1,3-dimethylindazole;ethane |
| SMILES | CC.Cc1nn(C)c2cc(Br)cc(C(F)F)c12 |
| InChI | InChI=1S/C10H9BrF2N2.C2H6/c1-5-9-7(10(12)13)3-6(11)4-8(9)15(2)14-5;1-2/h3-4,10H,1-2H3;1-2H3 |
| InChIKey | WIQRBMACWPICBN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |