C23H31F2NO2U — CID 162593186
(5R)-3,3-difluoro-5-[(E,3S,4R)-3-hydroxy-4-methylnon-1-en-6-ynyl]-1-nona-4,6-dienylpyrrolidin-2-one;uranium(2+) (PubChem CID 162593186) has the molecular formula C23H31F2NO2U and a molecular weight of 629.53 g/mol. Its IUPAC name is (5R)-3,3-difluoro-5-[(E,3S,4R)-3-hydroxy-4-methylnon-1-en-6-ynyl]-1-nona-4,6-dienylpyrrolidin-2-one;uranium(2+).
| Compound Name | (5R)-3,3-difluoro-5-[(E,3S,4R)-3-hydroxy-4-methylnon-1-en-6-ynyl]-1-nona-4,6-dienylpyrrolidin-2-one;uranium(2+) |
|---|---|
| PubChem CID | 162593186 |
| Molecular Formula | C23H31F2NO2U |
| Molecular Weight | 629.53 g/mol |
| Exact Mass | 629.28 |
| IUPAC Name | (5R)-3,3-difluoro-5-[(E,3S,4R)-3-hydroxy-4-methylnon-1-en-6-ynyl]-1-nona-4,6-dienylpyrrolidin-2-one;uranium(2+) |
| SMILES | CCC#CC[C@@H](C)[C@H](O)/C=C/[C@H]1CC(F)(F)C(=O)N1CCC/[C-]=C/C=[C-]/CC.[U+2] |
| InChI | InChI=1S/C23H31F2NO2.U/c1-4-6-8-9-10-11-13-17-26-20(18-23(24,25)22(26)28)15-16-21(27)19(3)14-12-7-5-2;/h8-9,15-16,19-21,27H,4-5,11,13-14,17-18H2,1-3H3;/q-2;+2/b16-15+;/t19-,20+,21-;/m1./s1 |
| InChIKey | TYJNZAWICCQLLH-NPJBNYBASA-N |
| XLogP | 4.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|