C15H21F3N6 — CID 162596571
2-N,4-N-di(propan-2-yl)-6-[6-(trifluoromethyl)-2-pyridinyl]-1,4-dihydro-1,3,5-triazine-2,4-diamine (PubChem CID 162596571) has the molecular formula C15H21F3N6 and a molecular weight of 342.37 g/mol. Its IUPAC name is 2-N,4-N-di(propan-2-yl)-6-[6-(trifluoromethyl)-2-pyridinyl]-1,4-dihydro-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-di(propan-2-yl)-6-[6-(trifluoromethyl)-2-pyridinyl]-1,4-dihydro-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 162596571 |
| Molecular Formula | C15H21F3N6 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 2-N,4-N-di(propan-2-yl)-6-[6-(trifluoromethyl)-2-pyridinyl]-1,4-dihydro-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)NC1=NC(NC(C)C)N=C(c2cccc(C(F)(F)F)n2)N1 |
| InChI | InChI=1S/C15H21F3N6/c1-8(2)19-13-22-12(23-14(24-13)20-9(3)4)10-6-5-7-11(21-10)15(16,17)18/h5-9,13,19H,1-4H3,(H2,20,22,23,24) |
| InChIKey | PWNJPYPSGDWVQM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |