C21H19F7N6 — CID 154348543
4-(4,4-difluorocyclohexyl)-2-N-(3,5-difluorophenyl)-6-[6-(trifluoromethyl)-2-pyridinyl]-1H-1,3,5-triazine-2,4-diamine (PubChem CID 154348543) has the molecular formula C21H19F7N6 and a molecular weight of 488.41 g/mol. Its IUPAC name is 4-(4,4-difluorocyclohexyl)-2-N-(3,5-difluorophenyl)-6-[6-(trifluoromethyl)-2-pyridinyl]-1H-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-(4,4-difluorocyclohexyl)-2-N-(3,5-difluorophenyl)-6-[6-(trifluoromethyl)-2-pyridinyl]-1H-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 154348543 |
| Molecular Formula | C21H19F7N6 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 4-(4,4-difluorocyclohexyl)-2-N-(3,5-difluorophenyl)-6-[6-(trifluoromethyl)-2-pyridinyl]-1H-1,3,5-triazine-2,4-diamine |
| SMILES | NC1(C2CCC(F)(F)CC2)N=C(Nc2cc(F)cc(F)c2)NC(c2cccc(C(F)(F)F)n2)=N1 |
| InChI | InChI=1S/C21H19F7N6/c22-12-8-13(23)10-14(9-12)30-18-32-17(15-2-1-3-16(31-15)20(26,27)28)33-21(29,34-18)11-4-6-19(24,25)7-5-11/h1-3,8-11H,4-7,29H2,(H2,30,32,33,34) |
| InChIKey | OSYUBDPYTSZNII-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |