C23H23F5N6 — CID 154307486
4-(3,3-difluorocyclopentyl)-2-(2,3-dihydro-1H-inden-2-ylimino)-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3-dihydro-1,3,5-triazin-4-amine (PubChem CID 154307486) has the molecular formula C23H23F5N6 and a molecular weight of 478.47 g/mol. Its IUPAC name is 4-(3,3-difluorocyclopentyl)-2-(2,3-dihydro-1H-inden-2-ylimino)-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3-dihydro-1,3,5-triazin-4-amine.
| Compound Name | 4-(3,3-difluorocyclopentyl)-2-(2,3-dihydro-1H-inden-2-ylimino)-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3-dihydro-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 154307486 |
| Molecular Formula | C23H23F5N6 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 4-(3,3-difluorocyclopentyl)-2-(2,3-dihydro-1H-inden-2-ylimino)-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3-dihydro-1,3,5-triazin-4-amine |
| SMILES | NC1(C2CCC(F)(F)C2)N=C(c2cccc(C(F)(F)F)n2)N/C(=N\C2Cc3ccccc3C2)N1 |
| InChI | InChI=1S/C23H23F5N6/c24-21(25)9-8-15(12-21)23(29)33-19(17-6-3-7-18(31-17)22(26,27)28)32-20(34-23)30-16-10-13-4-1-2-5-14(13)11-16/h1-7,15-16H,8-12,29H2,(H2,30,32,33,34) |
| InChIKey | APIHESKBLHVTHG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|