C19H21F7N6 — CID 158950077
4-[(1S)-3,3-difluorocyclopentyl]-2-[(1S)-3,3-difluorocyclopentyl]imino-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3-dihydro-1,3,5-triazin-4-amine (PubChem CID 158950077) has the molecular formula C19H21F7N6 and a molecular weight of 466.41 g/mol. Its IUPAC name is 4-[(1S)-3,3-difluorocyclopentyl]-2-[(1S)-3,3-difluorocyclopentyl]imino-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3-dihydro-1,3,5-triazin-4-amine.
| Compound Name | 4-[(1S)-3,3-difluorocyclopentyl]-2-[(1S)-3,3-difluorocyclopentyl]imino-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3-dihydro-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 158950077 |
| Molecular Formula | C19H21F7N6 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 4-[(1S)-3,3-difluorocyclopentyl]-2-[(1S)-3,3-difluorocyclopentyl]imino-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3-dihydro-1,3,5-triazin-4-amine |
| SMILES | NC1([C@H]2CCC(F)(F)C2)N=C(c2cccc(C(F)(F)F)n2)N/C(=N\[C@H]2CCC(F)(F)C2)N1 |
| InChI | InChI=1S/C19H21F7N6/c20-16(21)6-4-10(8-16)19(27)31-14(12-2-1-3-13(29-12)18(24,25)26)30-15(32-19)28-11-5-7-17(22,23)9-11/h1-3,10-11H,4-9,27H2,(H2,28,30,31,32)/t10-,11-,19?/m0/s1 |
| InChIKey | JLHSOOCGVZEHRO-JDSCLEBSSA-N |
| XLogP | 3.63 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|