C29H31F3N4O3 — CID 162598356
N-[2-[(1S,4S)-1-methyl-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]cyclobut-2-en-1-yl]propyl]-N,4-diphenyl-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 162598356) has the molecular formula C29H31F3N4O3 and a molecular weight of 540.59 g/mol. Its IUPAC name is N-[2-[(1S,4S)-1-methyl-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]cyclobut-2-en-1-yl]propyl]-N,4-diphenyl-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-[2-[(1S,4S)-1-methyl-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]cyclobut-2-en-1-yl]propyl]-N,4-diphenyl-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 162598356 |
| Molecular Formula | C29H31F3N4O3 |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | N-[2-[(1S,4S)-1-methyl-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]cyclobut-2-en-1-yl]propyl]-N,4-diphenyl-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CC(CN(C(=O)N1CC=C(c2ccccc2)CC1)c1ccccc1)[C@]1(C)C=C[C@@H]1C(=O)NNC(=O)C(F)(F)F |
| InChI | InChI=1S/C29H31F3N4O3/c1-20(28(2)16-13-24(28)25(37)33-34-26(38)29(30,31)32)19-36(23-11-7-4-8-12-23)27(39)35-17-14-22(15-18-35)21-9-5-3-6-10-21/h3-14,16,20,24H,15,17-19H2,1-2H3,(H,33,37)(H,34,38)/t20?,24-,28+/m1/s1 |
| InChIKey | XYNRASFFAZXWFE-YXOHZDMOSA-N |
| XLogP | 4.94 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|