C22H24F3N5 — CID 162598822
N-(3,6-dimethyl-1,2-dihydropyridin-4-yl)-2-[2-(trifluoromethyl)phenyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine (PubChem CID 162598822) has the molecular formula C22H24F3N5 and a molecular weight of 415.46 g/mol. Its IUPAC name is N-(3,6-dimethyl-1,2-dihydropyridin-4-yl)-2-[2-(trifluoromethyl)phenyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine.
| Compound Name | N-(3,6-dimethyl-1,2-dihydropyridin-4-yl)-2-[2-(trifluoromethyl)phenyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 162598822 |
| Molecular Formula | C22H24F3N5 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-(3,6-dimethyl-1,2-dihydropyridin-4-yl)-2-[2-(trifluoromethyl)phenyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
| SMILES | CC1=CC(Nc2nc(-c3ccccc3C(F)(F)F)nc3c2CCNCC3)=C(C)CN1 |
| InChI | InChI=1S/C22H24F3N5/c1-13-12-27-14(2)11-19(13)29-21-16-7-9-26-10-8-18(16)28-20(30-21)15-5-3-4-6-17(15)22(23,24)25/h3-6,11,26-27H,7-10,12H2,1-2H3,(H,28,29,30) |
| InChIKey | SOSVVPPPPNSMAF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |