C27H43F3N4O6 — CID 162598979
(1,1,1-trifluoro-2-methylpropan-2-yl) N-[1-[2-[(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)carbamoyl]-3-(2-methylpropyl)pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 162598979) has the molecular formula C27H43F3N4O6 and a molecular weight of 576.66 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) N-[1-[2-[(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)carbamoyl]-3-(2-methylpropyl)pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[1-[2-[(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)carbamoyl]-3-(2-methylpropyl)pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 162598979 |
| Molecular Formula | C27H43F3N4O6 |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[1-[2-[(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)carbamoyl]-3-(2-methylpropyl)pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)CC1CCN(C(=O)C(NC(=O)OC(C)(C)C(F)(F)F)C(C)(C)C)C1C(=O)NC(CC1CC1)C(=O)C(N)=O |
| InChI | InChI=1S/C27H43F3N4O6/c1-14(2)12-16-10-11-34(18(16)22(37)32-17(13-15-8-9-15)19(35)21(31)36)23(38)20(25(3,4)5)33-24(39)40-26(6,7)27(28,29)30/h14-18,20H,8-13H2,1-7H3,(H2,31,36)(H,32,37)(H,33,39) |
| InChIKey | XDKXDWXUEZTEER-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|