C25H39F3N4O6 — CID 58605838
(1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2S)-1-[(1R,2S,5S)-2-[[(3R)-1-amino-1,2-dioxohexan-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 58605838) has the molecular formula C25H39F3N4O6 and a molecular weight of 548.60 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2S)-1-[(1R,2S,5S)-2-[[(3R)-1-amino-1,2-dioxohexan-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2S)-1-[(1R,2S,5S)-2-[[(3R)-1-amino-1,2-dioxohexan-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58605838 |
| Molecular Formula | C25H39F3N4O6 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2S)-1-[(1R,2S,5S)-2-[[(3R)-1-amino-1,2-dioxohexan-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCC[C@@H](NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C(F)(F)F)C(C)(C)C)C2(C)C)C(=O)C(N)=O |
| InChI | InChI=1S/C25H39F3N4O6/c1-9-10-13(16(33)18(29)34)30-19(35)15-14-12(23(14,5)6)11-32(15)20(36)17(22(2,3)4)31-21(37)38-24(7,8)25(26,27)28/h12-15,17H,9-11H2,1-8H3,(H2,29,34)(H,30,35)(H,31,37)/t12-,13+,14-,15-,17+/m0/s1 |
| InChIKey | XDEXMRIUEWKUEP-CEEVZKBLSA-N |
| XLogP | 2.29 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|