C24H39N3O7 — CID 59115357
3-[[(1R,2S,5S)-3-[3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxopentanoic acid (PubChem CID 59115357) has the molecular formula C24H39N3O7 and a molecular weight of 481.59 g/mol. Its IUPAC name is 3-[[(1R,2S,5S)-3-[3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxopentanoic acid.
| Compound Name | 3-[[(1R,2S,5S)-3-[3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxopentanoic acid |
|---|---|
| PubChem CID | 59115357 |
| Molecular Formula | C24H39N3O7 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | 3-[[(1R,2S,5S)-3-[3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxopentanoic acid |
| SMILES | CCC(NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)C(NC(=O)OC(C)(C)C)C(C)(C)C)C2(C)C)C(=O)C(=O)O |
| InChI | InChI=1S/C24H39N3O7/c1-10-13(16(28)20(31)32)25-18(29)15-14-12(24(14,8)9)11-27(15)19(30)17(22(2,3)4)26-21(33)34-23(5,6)7/h12-15,17H,10-11H2,1-9H3,(H,25,29)(H,26,33)(H,31,32)/t12-,13?,14-,15-,17?/m0/s1 |
| InChIKey | NZKQKQXNTQAAMK-MLURZJSDSA-N |
| XLogP | 1.96 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|