C26H41N3O7 — CID 58908992
4-cyclopropyl-3-[[(1R,2S,5S)-3-[3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxobutanoic acid (PubChem CID 58908992) has the molecular formula C26H41N3O7 and a molecular weight of 507.63 g/mol. Its IUPAC name is 4-cyclopropyl-3-[[(1R,2S,5S)-3-[3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxobutanoic acid.
| Compound Name | 4-cyclopropyl-3-[[(1R,2S,5S)-3-[3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxobutanoic acid |
|---|---|
| PubChem CID | 58908992 |
| Molecular Formula | C26H41N3O7 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | 4-cyclopropyl-3-[[(1R,2S,5S)-3-[3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NC(CC1CC1)C(=O)C(=O)O)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H41N3O7/c1-24(2,3)19(28-23(35)36-25(4,5)6)21(32)29-12-14-16(26(14,7)8)17(29)20(31)27-15(11-13-9-10-13)18(30)22(33)34/h13-17,19H,9-12H2,1-8H3,(H,27,31)(H,28,35)(H,33,34)/t14-,15?,16-,17-,19?/m0/s1 |
| InChIKey | GVGHOVXYZSHTGT-UEMOBTBKSA-N |
| XLogP | 2.35 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|