C27H43N3O7 — CID 58908841
methyl 4-cyclopropyl-3-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxobutanoate (PubChem CID 58908841) has the molecular formula C27H43N3O7 and a molecular weight of 521.66 g/mol. Its IUPAC name is methyl 4-cyclopropyl-3-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxobutanoate.
| Compound Name | methyl 4-cyclopropyl-3-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxobutanoate |
|---|---|
| PubChem CID | 58908841 |
| Molecular Formula | C27H43N3O7 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | methyl 4-cyclopropyl-3-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxobutanoate |
| SMILES | COC(=O)C(=O)C(CC1CC1)NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C27H43N3O7/c1-25(2,3)20(29-24(35)37-26(4,5)6)22(33)30-13-15-17(27(15,7)8)18(30)21(32)28-16(12-14-10-11-14)19(31)23(34)36-9/h14-18,20H,10-13H2,1-9H3,(H,28,32)(H,29,35)/t15-,16?,17-,18-,20+/m0/s1 |
| InChIKey | DGOMRNFJOGGJKH-DOVBMPENSA-N |
| XLogP | 2.44 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|