C28H28F3N7O4 — CID 162599414
4-[[8-tert-butyl-2,4-dioxo-3-[4-(trifluoromethoxy)phenyl]-1,3-diazaspiro[4.5]dec-6-en-1-yl]methyl]-N-(2H-tetrazol-5-yl)benzamide (PubChem CID 162599414) has the molecular formula C28H28F3N7O4 and a molecular weight of 583.57 g/mol. Its IUPAC name is 4-[[8-tert-butyl-2,4-dioxo-3-[4-(trifluoromethoxy)phenyl]-1,3-diazaspiro[4.5]dec-6-en-1-yl]methyl]-N-(2H-tetrazol-5-yl)benzamide.
| Compound Name | 4-[[8-tert-butyl-2,4-dioxo-3-[4-(trifluoromethoxy)phenyl]-1,3-diazaspiro[4.5]dec-6-en-1-yl]methyl]-N-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 162599414 |
| Molecular Formula | C28H28F3N7O4 |
| Molecular Weight | 583.57 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | 4-[[8-tert-butyl-2,4-dioxo-3-[4-(trifluoromethoxy)phenyl]-1,3-diazaspiro[4.5]dec-6-en-1-yl]methyl]-N-(2H-tetrazol-5-yl)benzamide |
| SMILES | CC(C)(C)C1C=CC2(CC1)C(=O)N(c1ccc(OC(F)(F)F)cc1)C(=O)N2Cc1ccc(C(=O)Nc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C28H28F3N7O4/c1-26(2,3)19-12-14-27(15-13-19)23(40)38(20-8-10-21(11-9-20)42-28(29,30)31)25(41)37(27)16-17-4-6-18(7-5-17)22(39)32-24-33-35-36-34-24/h4-12,14,19H,13,15-16H2,1-3H3,(H2,32,33,34,35,36,39) |
| InChIKey | VVUSCDMMJGJBCH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|