C30H31F3N8O4 — CID 142904924
N-[(Z)-N-aminocarbamohydrazonoyl]-4-[[8-benzyl-2,4-dioxo-3-[4-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]decan-1-yl]methyl]benzamide (PubChem CID 142904924) has the molecular formula C30H31F3N8O4 and a molecular weight of 624.62 g/mol. Its IUPAC name is N-[(Z)-N-aminocarbamohydrazonoyl]-4-[[8-benzyl-2,4-dioxo-3-[4-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]decan-1-yl]methyl]benzamide.
| Compound Name | N-[(Z)-N-aminocarbamohydrazonoyl]-4-[[8-benzyl-2,4-dioxo-3-[4-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]decan-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 142904924 |
| Molecular Formula | C30H31F3N8O4 |
| Molecular Weight | 624.62 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | N-[(Z)-N-aminocarbamohydrazonoyl]-4-[[8-benzyl-2,4-dioxo-3-[4-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]decan-1-yl]methyl]benzamide |
| SMILES | N/N=C(\NN)NC(=O)c1ccc(CN2C(=O)N(c3ccc(OC(F)(F)F)cc3)C(=O)C23CCN(Cc2ccccc2)CC3)cc1 |
| InChI | InChI=1S/C30H31F3N8O4/c31-30(32,33)45-24-12-10-23(11-13-24)41-26(43)29(14-16-39(17-15-29)18-20-4-2-1-3-5-20)40(28(41)44)19-21-6-8-22(9-7-21)25(42)36-27(37-34)38-35/h1-13H,14-19,34-35H2,(H2,36,37,38,42) |
| InChIKey | VIMKPBFBVSWPTH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 158.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.62 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|