C25H30F3N7O2 — CID 142930071
N-[(Z)-N-aminocarbamohydrazonoyl]-4-[[2-cyclohexyl-3-[4-(trifluoromethoxy)phenyl]-1,5-dihydropyrazol-5-yl]methyl]benzamide (PubChem CID 142930071) has the molecular formula C25H30F3N7O2 and a molecular weight of 517.56 g/mol. Its IUPAC name is N-[(Z)-N-aminocarbamohydrazonoyl]-4-[[2-cyclohexyl-3-[4-(trifluoromethoxy)phenyl]-1,5-dihydropyrazol-5-yl]methyl]benzamide.
| Compound Name | N-[(Z)-N-aminocarbamohydrazonoyl]-4-[[2-cyclohexyl-3-[4-(trifluoromethoxy)phenyl]-1,5-dihydropyrazol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 142930071 |
| Molecular Formula | C25H30F3N7O2 |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | N-[(Z)-N-aminocarbamohydrazonoyl]-4-[[2-cyclohexyl-3-[4-(trifluoromethoxy)phenyl]-1,5-dihydropyrazol-5-yl]methyl]benzamide |
| SMILES | N/N=C(\NN)NC(=O)c1ccc(CC2C=C(c3ccc(OC(F)(F)F)cc3)N(C3CCCCC3)N2)cc1 |
| InChI | InChI=1S/C25H30F3N7O2/c26-25(27,28)37-21-12-10-17(11-13-21)22-15-19(34-35(22)20-4-2-1-3-5-20)14-16-6-8-18(9-7-16)23(36)31-24(32-29)33-30/h6-13,15,19-20,34H,1-5,14,29-30H2,(H2,31,32,33,36) |
| InChIKey | HCLQTMKCBVCQGL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|