C30H33F3N8O3 — CID 142904857
N-[(Z)-N-aminocarbamohydrazonoyl]-4-[[8-benzyl-2-oxo-3-[4-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]decan-1-yl]methyl]benzamide (PubChem CID 142904857) has the molecular formula C30H33F3N8O3 and a molecular weight of 610.64 g/mol. Its IUPAC name is N-[(Z)-N-aminocarbamohydrazonoyl]-4-[[8-benzyl-2-oxo-3-[4-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]decan-1-yl]methyl]benzamide.
| Compound Name | N-[(Z)-N-aminocarbamohydrazonoyl]-4-[[8-benzyl-2-oxo-3-[4-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]decan-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 142904857 |
| Molecular Formula | C30H33F3N8O3 |
| Molecular Weight | 610.64 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | N-[(Z)-N-aminocarbamohydrazonoyl]-4-[[8-benzyl-2-oxo-3-[4-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]decan-1-yl]methyl]benzamide |
| SMILES | N/N=C(\NN)NC(=O)c1ccc(CN2C(=O)N(c3ccc(OC(F)(F)F)cc3)CC23CCN(Cc2ccccc2)CC3)cc1 |
| InChI | InChI=1S/C30H33F3N8O3/c31-30(32,33)44-25-12-10-24(11-13-25)40-20-29(14-16-39(17-15-29)18-21-4-2-1-3-5-21)41(28(40)43)19-22-6-8-23(9-7-22)26(42)36-27(37-34)38-35/h1-13H,14-20,34-35H2,(H2,36,37,38,42) |
| InChIKey | SLSXSOZQEGBSSI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 141.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|