C25H21BrF6N8O2 — CID 143077365
N-[(Z)-N-aminocarbamohydrazonoyl]-4-[[4-bromo-3-methyl-2-[4-(trifluoromethoxy)phenyl]imino-6-(trifluoromethyl)benzimidazol-1-yl]methyl]benzamide (PubChem CID 143077365) has the molecular formula C25H21BrF6N8O2 and a molecular weight of 659.39 g/mol. Its IUPAC name is N-[(Z)-N-aminocarbamohydrazonoyl]-4-[[4-bromo-3-methyl-2-[4-(trifluoromethoxy)phenyl]imino-6-(trifluoromethyl)benzimidazol-1-yl]methyl]benzamide.
| Compound Name | N-[(Z)-N-aminocarbamohydrazonoyl]-4-[[4-bromo-3-methyl-2-[4-(trifluoromethoxy)phenyl]imino-6-(trifluoromethyl)benzimidazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 143077365 |
| Molecular Formula | C25H21BrF6N8O2 |
| Molecular Weight | 659.39 g/mol |
| Exact Mass | 658.09 |
| IUPAC Name | N-[(Z)-N-aminocarbamohydrazonoyl]-4-[[4-bromo-3-methyl-2-[4-(trifluoromethoxy)phenyl]imino-6-(trifluoromethyl)benzimidazol-1-yl]methyl]benzamide |
| SMILES | Cn1/c(=N\c2ccc(OC(F)(F)F)cc2)n(Cc2ccc(C(=O)N/C(=N/N)NN)cc2)c2cc(C(F)(F)F)cc(Br)c21 |
| InChI | InChI=1S/C25H21BrF6N8O2/c1-39-20-18(26)10-15(24(27,28)29)11-19(20)40(23(39)35-16-6-8-17(9-7-16)42-25(30,31)32)12-13-2-4-14(5-3-13)21(41)36-22(37-33)38-34/h2-11H,12,33-34H2,1H3,(H2,36,37,38,41)/b35-23+ |
| InChIKey | BKWLAJBUDOJWRM-QCFMCPCVSA-N |
| XLogP | 4.36 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|