C22H30F6N2O3 — CID 162600889
N-[3,5-bis(trifluoromethyl)phenyl]-2-[4-[hydroxy-[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]cyclohexyl]acetamide (PubChem CID 162600889) has the molecular formula C22H30F6N2O3 and a molecular weight of 484.48 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-[4-[hydroxy-[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]cyclohexyl]acetamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-[4-[hydroxy-[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 162600889 |
| Molecular Formula | C22H30F6N2O3 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-[4-[hydroxy-[(2S)-2-hydroxy-3,3-dimethylbutyl]amino]cyclohexyl]acetamide |
| SMILES | CC(C)(C)[C@H](O)CN(O)C1CCC(CC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H30F6N2O3/c1-20(2,3)18(31)12-30(33)17-6-4-13(5-7-17)8-19(32)29-16-10-14(21(23,24)25)9-15(11-16)22(26,27)28/h9-11,13,17-18,31,33H,4-8,12H2,1-3H3,(H,29,32)/t13?,17?,18-/m1/s1 |
| InChIKey | NQXLGOHXROBVIA-ZTUNLMCQSA-N |
| XLogP | 5.71 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|