C27H24F3NO5 — CID 162600994
methyl 2-[3-[2-[(2-oxo-4,4a,8a,8b-tetrahydro-3aH-indeno[2,1-d][1,3]oxazol-3-yl)methyl]-4-(trifluoromethyl)phenoxy]phenyl]acetate (PubChem CID 162600994) has the molecular formula C27H24F3NO5 and a molecular weight of 499.49 g/mol. Its IUPAC name is methyl 2-[3-[2-[(2-oxo-4,4a,8a,8b-tetrahydro-3aH-indeno[2,1-d][1,3]oxazol-3-yl)methyl]-4-(trifluoromethyl)phenoxy]phenyl]acetate.
| Compound Name | methyl 2-[3-[2-[(2-oxo-4,4a,8a,8b-tetrahydro-3aH-indeno[2,1-d][1,3]oxazol-3-yl)methyl]-4-(trifluoromethyl)phenoxy]phenyl]acetate |
|---|---|
| PubChem CID | 162600994 |
| Molecular Formula | C27H24F3NO5 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | methyl 2-[3-[2-[(2-oxo-4,4a,8a,8b-tetrahydro-3aH-indeno[2,1-d][1,3]oxazol-3-yl)methyl]-4-(trifluoromethyl)phenoxy]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(Oc2ccc(C(F)(F)F)cc2CN2C(=O)OC3C4C=CC=CC4CC32)c1 |
| InChI | InChI=1S/C27H24F3NO5/c1-34-24(32)12-16-5-4-7-20(11-16)35-23-10-9-19(27(28,29)30)13-18(23)15-31-22-14-17-6-2-3-8-21(17)25(22)36-26(31)33/h2-11,13,17,21-22,25H,12,14-15H2,1H3 |
| InChIKey | KAONXKJIDOQYGH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |