C11H8ClF3O2 — CID 162602228
4-(5-chlorocyclohepta-1,4,6-trien-1-yl)-1,1,1-trifluoro-4-hydroxybut-3-en-2-one (PubChem CID 162602228) has the molecular formula C11H8ClF3O2 and a molecular weight of 264.63 g/mol. Its IUPAC name is 4-(5-chlorocyclohepta-1,4,6-trien-1-yl)-1,1,1-trifluoro-4-hydroxybut-3-en-2-one.
| Compound Name | 4-(5-chlorocyclohepta-1,4,6-trien-1-yl)-1,1,1-trifluoro-4-hydroxybut-3-en-2-one |
|---|---|
| PubChem CID | 162602228 |
| Molecular Formula | C11H8ClF3O2 |
| Molecular Weight | 264.63 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 4-(5-chlorocyclohepta-1,4,6-trien-1-yl)-1,1,1-trifluoro-4-hydroxybut-3-en-2-one |
| SMILES | O=C(C=C(O)C1=CCC=C(Cl)C=C1)C(F)(F)F |
| InChI | InChI=1S/C11H8ClF3O2/c12-8-3-1-2-7(4-5-8)9(16)6-10(17)11(13,14)15/h2-6,16H,1H2 |
| InChIKey | XXXNVIIOZVKVBW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.63 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|