C29H29F6NO4 — CID 162608230
(2S,3R)-3-[2-[2-[(1R)-1-[2,5-bis(trifluoromethyl)phenyl]ethyl]-2-azatricyclo[4.1.0.01,3]heptan-5-yl]-3,4-dihydro-2H-chromen-7-yl]-3-hydroxy-2-methylpropanoic acid (PubChem CID 162608230) has the molecular formula C29H29F6NO4 and a molecular weight of 569.54 g/mol. Its IUPAC name is (2S,3R)-3-[2-[2-[(1R)-1-[2,5-bis(trifluoromethyl)phenyl]ethyl]-2-azatricyclo[4.1.0.01,3]heptan-5-yl]-3,4-dihydro-2H-chromen-7-yl]-3-hydroxy-2-methylpropanoic acid.
| Compound Name | (2S,3R)-3-[2-[2-[(1R)-1-[2,5-bis(trifluoromethyl)phenyl]ethyl]-2-azatricyclo[4.1.0.01,3]heptan-5-yl]-3,4-dihydro-2H-chromen-7-yl]-3-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 162608230 |
| Molecular Formula | C29H29F6NO4 |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | (2S,3R)-3-[2-[2-[(1R)-1-[2,5-bis(trifluoromethyl)phenyl]ethyl]-2-azatricyclo[4.1.0.01,3]heptan-5-yl]-3,4-dihydro-2H-chromen-7-yl]-3-hydroxy-2-methylpropanoic acid |
| SMILES | C[C@H](C(=O)O)[C@@H](O)c1ccc2c(c1)OC(C1CC3N([C@H](C)c4cc(C(F)(F)F)ccc4C(F)(F)F)C34CC14)CC2 |
| InChI | InChI=1S/C29H29F6NO4/c1-13(26(38)39)25(37)16-4-3-15-5-8-22(40-23(15)9-16)19-11-24-27(12-21(19)27)36(24)14(2)18-10-17(28(30,31)32)6-7-20(18)29(33,34)35/h3-4,6-7,9-10,13-14,19,21-22,24-25,37H,5,8,11-12H2,1-2H3,(H,38,39)/t13-,14+,19?,21?,22?,24?,25+,27?,36?/m0/s1 |
| InChIKey | FRXWSKGGAVFUNL-MTILQTOKSA-N |
| XLogP | 6.40 |
| TPSA | 69.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|