C33H37F6NO3 — CID 166658917
3-[2-[(1R,5S)-8-[1-[2,5-bis(trifluoromethyl)phenyl]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]-3,4-dihydro-2H-chromen-7-yl]-3-cyclopropyl-2-methylpropanoic acid (PubChem CID 166658917) has the molecular formula C33H37F6NO3 and a molecular weight of 609.65 g/mol. Its IUPAC name is 3-[2-[(1R,5S)-8-[1-[2,5-bis(trifluoromethyl)phenyl]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]-3,4-dihydro-2H-chromen-7-yl]-3-cyclopropyl-2-methylpropanoic acid.
| Compound Name | 3-[2-[(1R,5S)-8-[1-[2,5-bis(trifluoromethyl)phenyl]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]-3,4-dihydro-2H-chromen-7-yl]-3-cyclopropyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 166658917 |
| Molecular Formula | C33H37F6NO3 |
| Molecular Weight | 609.65 g/mol |
| Exact Mass | 609.27 |
| IUPAC Name | 3-[2-[(1R,5S)-8-[1-[2,5-bis(trifluoromethyl)phenyl]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]-3,4-dihydro-2H-chromen-7-yl]-3-cyclopropyl-2-methylpropanoic acid |
| SMILES | CC(C(=O)O)C(c1ccc2c(c1)OC(C1C[C@H]3CC[C@@H](C1)N3C(C)c1cc(C(F)(F)F)ccc1C(F)(F)F)CC2)C1CC1 |
| InChI | InChI=1S/C33H37F6NO3/c1-17(31(41)42)30(20-4-5-20)21-6-3-19-7-12-28(43-29(19)15-21)22-13-24-9-10-25(14-22)40(24)18(2)26-16-23(32(34,35)36)8-11-27(26)33(37,38)39/h3,6,8,11,15-18,20,22,24-25,28,30H,4-5,7,9-10,12-14H2,1-2H3,(H,41,42)/t17?,18?,22?,24-,25+,28?,30? |
| InChIKey | QAIWTFNBTFMLAS-QNNMFDBVSA-N |
| XLogP | 8.64 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.65 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |