C28H37F3N4S — CID 162608281
N,N-dimethyl-6-phenyl-5-[(4S)-1-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]azepan-4-yl]hexan-1-amine (PubChem CID 162608281) has the molecular formula C28H37F3N4S and a molecular weight of 518.69 g/mol. Its IUPAC name is N,N-dimethyl-6-phenyl-5-[(4S)-1-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]azepan-4-yl]hexan-1-amine.
| Compound Name | N,N-dimethyl-6-phenyl-5-[(4S)-1-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]azepan-4-yl]hexan-1-amine |
|---|---|
| PubChem CID | 162608281 |
| Molecular Formula | C28H37F3N4S |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | N,N-dimethyl-6-phenyl-5-[(4S)-1-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]azepan-4-yl]hexan-1-amine |
| SMILES | CN(C)CCCCC(Cc1ccccc1)[C@H]1CCCN(c2ncnc3sc(CC(F)(F)F)cc23)CC1 |
| InChI | InChI=1S/C28H37F3N4S/c1-34(2)14-7-6-11-23(17-21-9-4-3-5-10-21)22-12-8-15-35(16-13-22)26-25-18-24(19-28(29,30)31)36-27(25)33-20-32-26/h3-5,9-10,18,20,22-23H,6-8,11-17,19H2,1-2H3/t22-,23?/m0/s1 |
| InChIKey | DLJPOAKTKKJQKP-NQCNTLBGSA-N |
| XLogP | 6.99 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|