C13H15ClF3N3OS — CID 162610260
(Z)-2-(2-aminopropylsulfanyl)-N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]but-2-enamide (PubChem CID 162610260) has the molecular formula C13H15ClF3N3OS and a molecular weight of 353.80 g/mol. Its IUPAC name is (Z)-2-(2-aminopropylsulfanyl)-N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]but-2-enamide.
| Compound Name | (Z)-2-(2-aminopropylsulfanyl)-N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]but-2-enamide |
|---|---|
| PubChem CID | 162610260 |
| Molecular Formula | C13H15ClF3N3OS |
| Molecular Weight | 353.80 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | (Z)-2-(2-aminopropylsulfanyl)-N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]but-2-enamide |
| SMILES | C/C=C(\SCC(C)N)C(=O)Nc1cc(C(F)(F)F)c(Cl)cn1 |
| InChI | InChI=1S/C13H15ClF3N3OS/c1-3-10(22-6-7(2)18)12(21)20-11-4-8(13(15,16)17)9(14)5-19-11/h3-5,7H,6,18H2,1-2H3,(H,19,20,21)/b10-3- |
| InChIKey | PLFYYJQDBLQQBP-KMKOMSMNSA-N |
| XLogP | 3.68 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.80 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|