C17H26F2N4O — CID 162611129
2-(difluoromethoxy)-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]aniline (PubChem CID 162611129) has the molecular formula C17H26F2N4O and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-(difluoromethoxy)-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]aniline.
| Compound Name | 2-(difluoromethoxy)-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]aniline |
|---|---|
| PubChem CID | 162611129 |
| Molecular Formula | C17H26F2N4O |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 2-(difluoromethoxy)-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]aniline |
| SMILES | CN1CCN(C2CCN(c3ccc(N)c(OC(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C17H26F2N4O/c1-21-8-10-23(11-9-21)13-4-6-22(7-5-13)14-2-3-15(20)16(12-14)24-17(18)19/h2-3,12-13,17H,4-11,20H2,1H3 |
| InChIKey | FVUBCGWFKIAJSX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 44.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|