C17H27N5O2 — CID 175146069
[2-amino-5-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl] carbamate (PubChem CID 175146069) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is [2-amino-5-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl] carbamate.
| Compound Name | [2-amino-5-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl] carbamate |
|---|---|
| PubChem CID | 175146069 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | [2-amino-5-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl] carbamate |
| SMILES | CN1CCN(C2CCN(c3ccc(N)c(OC(N)=O)c3)CC2)CC1 |
| InChI | InChI=1S/C17H27N5O2/c1-20-8-10-22(11-9-20)13-4-6-21(7-5-13)14-2-3-15(18)16(12-14)24-17(19)23/h2-3,12-13H,4-11,18H2,1H3,(H2,19,23) |
| InChIKey | MBOHOWNQSPZMGJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|