About 4-(difluoromethyl)-6-fluoro-2,3-dihydropyridine
4-(difluoromethyl)-6-fluoro-2,3-dihydropyridine (PubChem CID 162611855) has the molecular formula C6H6F3N
and a molecular weight of 149.12 g/mol. Its IUPAC name is 4-(difluoromethyl)-6-fluoro-2,3-dihydropyridine.
Analyze 4-(difluoromethyl)-6-fluoro-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-6-fluoro-2,3-dihydropyridine?
The IUPAC name of 4-(difluoromethyl)-6-fluoro-2,3-dihydropyridine (CID 162611855) is 4-(difluoromethyl)-6-fluoro-2,3-dihydropyridine.
What is the SMILES notation for 4-(difluoromethyl)-6-fluoro-2,3-dihydropyridine?
The canonical SMILES for 4-(difluoromethyl)-6-fluoro-2,3-dihydropyridine is FC1=NCCC(C(F)F)=C1.
What is the InChIKey of 4-(difluoromethyl)-6-fluoro-2,3-dihydropyridine?
The InChIKey is YMCMMGMSRDBBNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F3N/c7-5-3-4(6(8)9)1-2-10-5/h3,6H,1-2H2.
What are the key properties of 4-(difluoromethyl)-6-fluoro-2,3-dihydropyridine?
4-(difluoromethyl)-6-fluoro-2,3-dihydropyridine has a molecular weight of 149.12 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-6-fluoro-2,3-dihydropyridine is sourced from PubChem (CID 162611855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).