C11H15F3O2S — CID 162611922
2-[(2R)-5,5,5-trifluoro-2,4-dimethoxypentan-2-yl]thiophene (PubChem CID 162611922) has the molecular formula C11H15F3O2S and a molecular weight of 268.30 g/mol. Its IUPAC name is 2-[(2R)-5,5,5-trifluoro-2,4-dimethoxypentan-2-yl]thiophene.
| Compound Name | 2-[(2R)-5,5,5-trifluoro-2,4-dimethoxypentan-2-yl]thiophene |
|---|---|
| PubChem CID | 162611922 |
| Molecular Formula | C11H15F3O2S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-[(2R)-5,5,5-trifluoro-2,4-dimethoxypentan-2-yl]thiophene |
| SMILES | COC(C[C@@](C)(OC)c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C11H15F3O2S/c1-10(16-3,9-5-4-6-17-9)7-8(15-2)11(12,13)14/h4-6,8H,7H2,1-3H3/t8?,10-/m1/s1 |
| InChIKey | OWOURJGHEQSOEV-LHIURRSHSA-N |
| XLogP | 3.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |