C32H30F6N2O6S2 — CID 57258524
bis[1-amino-3-thiophen-2-yl-3-[4-(trifluoromethyl)phenoxy]butyl] oxalate (PubChem CID 57258524) has the molecular formula C32H30F6N2O6S2 and a molecular weight of 716.72 g/mol. Its IUPAC name is bis[1-amino-3-thiophen-2-yl-3-[4-(trifluoromethyl)phenoxy]butyl] oxalate.
| Compound Name | bis[1-amino-3-thiophen-2-yl-3-[4-(trifluoromethyl)phenoxy]butyl] oxalate |
|---|---|
| PubChem CID | 57258524 |
| Molecular Formula | C32H30F6N2O6S2 |
| Molecular Weight | 716.72 g/mol |
| Exact Mass | 716.14 |
| IUPAC Name | bis[1-amino-3-thiophen-2-yl-3-[4-(trifluoromethyl)phenoxy]butyl] oxalate |
| SMILES | CC(CC(N)OC(=O)C(=O)OC(N)CC(C)(Oc1ccc(C(F)(F)F)cc1)c1cccs1)(Oc1ccc(C(F)(F)F)cc1)c1cccs1 |
| InChI | InChI=1S/C32H30F6N2O6S2/c1-29(23-5-3-15-47-23,45-21-11-7-19(8-12-21)31(33,34)35)17-25(39)43-27(41)28(42)44-26(40)18-30(2,24-6-4-16-48-24)46-22-13-9-20(10-14-22)32(36,37)38/h3-16,25-26H,17-18,39-40H2,1-2H3 |
| InChIKey | TXZKUCLNOORWMQ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.72 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|