C18H18F3N4OS+ — CID 162614110
CID 162614110 (PubChem CID 162614110) has the molecular formula C18H18F3N4OS+ and a molecular weight of 395.43 g/mol.
| Compound Name | CID 162614110 |
|---|---|
| PubChem CID | 162614110 |
| Molecular Formula | C18H18F3N4OS+ |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | — |
| SMILES | [H]N=[S+](O)(CC)c1cc(C2CC2)cnc1-c1cn2ccc(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C18H18F3N4OS/c1-2-27(22,26)15-7-12(11-3-4-11)9-23-17(15)14-10-25-6-5-13(18(19,20)21)8-16(25)24-14/h5-11H,2-4H2,1H3,(H2,22,26)/q+1 |
| InChIKey | KCXLWFDNDPSQTO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|