C18H13F3N6 — CID 170147503
N-methyl-1-[5-[2-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-7-yl]-2H-triazol-4-yl]methanimine (PubChem CID 170147503) has the molecular formula C18H13F3N6 and a molecular weight of 370.34 g/mol. Its IUPAC name is N-methyl-1-[5-[2-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-7-yl]-2H-triazol-4-yl]methanimine.
| Compound Name | N-methyl-1-[5-[2-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-7-yl]-2H-triazol-4-yl]methanimine |
|---|---|
| PubChem CID | 170147503 |
| Molecular Formula | C18H13F3N6 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-methyl-1-[5-[2-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-7-yl]-2H-triazol-4-yl]methanimine |
| SMILES | C/N=C/c1n[nH]nc1-c1ccn2cc(-c3ccc(C(F)(F)F)cc3)nc2c1 |
| InChI | InChI=1S/C18H13F3N6/c1-22-9-14-17(25-26-24-14)12-6-7-27-10-15(23-16(27)8-12)11-2-4-13(5-3-11)18(19,20)21/h2-10H,1H3,(H,24,25,26)/b22-9+ |
| InChIKey | JJXNPKIKPBDGTE-LSFURLLWSA-N |
| XLogP | 3.85 |
| TPSA | 71.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|