C18H15F3N4 — CID 170147492
N-methyl-1-[5-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]-2H-triazol-4-yl]methanimine (PubChem CID 170147492) has the molecular formula C18H15F3N4 and a molecular weight of 344.34 g/mol. Its IUPAC name is N-methyl-1-[5-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]-2H-triazol-4-yl]methanimine.
| Compound Name | N-methyl-1-[5-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]-2H-triazol-4-yl]methanimine |
|---|---|
| PubChem CID | 170147492 |
| Molecular Formula | C18H15F3N4 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-methyl-1-[5-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]-2H-triazol-4-yl]methanimine |
| SMILES | C/N=C/c1n[nH]nc1Cc1ccc(-c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H15F3N4/c1-22-11-17-16(23-25-24-17)9-12-5-7-13(8-6-12)14-3-2-4-15(10-14)18(19,20)21/h2-8,10-11H,9H2,1H3,(H,23,24,25)/b22-11+ |
| InChIKey | DGPKTZBILOOUHT-SSDVNMTOSA-N |
| XLogP | 4.13 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|