C21H15F3N4S — CID 170147384
N-[[5-[3-[5-[3-(trifluoromethyl)phenyl]thiophen-2-yl]phenyl]-2H-triazol-4-yl]methyl]methanimine (PubChem CID 170147384) has the molecular formula C21H15F3N4S and a molecular weight of 412.44 g/mol. Its IUPAC name is N-[[5-[3-[5-[3-(trifluoromethyl)phenyl]thiophen-2-yl]phenyl]-2H-triazol-4-yl]methyl]methanimine.
| Compound Name | N-[[5-[3-[5-[3-(trifluoromethyl)phenyl]thiophen-2-yl]phenyl]-2H-triazol-4-yl]methyl]methanimine |
|---|---|
| PubChem CID | 170147384 |
| Molecular Formula | C21H15F3N4S |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-[[5-[3-[5-[3-(trifluoromethyl)phenyl]thiophen-2-yl]phenyl]-2H-triazol-4-yl]methyl]methanimine |
| SMILES | C=NCc1n[nH]nc1-c1cccc(-c2ccc(-c3cccc(C(F)(F)F)c3)s2)c1 |
| InChI | InChI=1S/C21H15F3N4S/c1-25-12-17-20(27-28-26-17)15-6-2-4-13(10-15)18-8-9-19(29-18)14-5-3-7-16(11-14)21(22,23)24/h2-11H,1,12H2,(H,26,27,28) |
| InChIKey | NONNMJBZNNVKGE-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|