C30H14Br2F6N2S2 — CID 88981099
5,8-bis(5-bromothiophen-2-yl)-2,3-bis[3-(trifluoromethyl)phenyl]quinoxaline (PubChem CID 88981099) has the molecular formula C30H14Br2F6N2S2 and a molecular weight of 740.39 g/mol. Its IUPAC name is 5,8-bis(5-bromothiophen-2-yl)-2,3-bis[3-(trifluoromethyl)phenyl]quinoxaline.
| Compound Name | 5,8-bis(5-bromothiophen-2-yl)-2,3-bis[3-(trifluoromethyl)phenyl]quinoxaline |
|---|---|
| PubChem CID | 88981099 |
| Molecular Formula | C30H14Br2F6N2S2 |
| Molecular Weight | 740.39 g/mol |
| Exact Mass | 737.89 |
| IUPAC Name | 5,8-bis(5-bromothiophen-2-yl)-2,3-bis[3-(trifluoromethyl)phenyl]quinoxaline |
| SMILES | FC(F)(F)c1cccc(-c2nc3c(-c4ccc(Br)s4)ccc(-c4ccc(Br)s4)c3nc2-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C30H14Br2F6N2S2/c31-23-11-9-21(41-23)19-7-8-20(22-10-12-24(32)42-22)28-27(19)39-25(15-3-1-5-17(13-15)29(33,34)35)26(40-28)16-4-2-6-18(14-16)30(36,37)38/h1-14H |
| InChIKey | DKUMSNBWCJTZMY-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.39 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |